C21H30O3 — CID 134930939
(6R,7R)-7-[(E)-2-(phenylmethoxymethoxy)ethenyl]undec-4-yn-6-ol (PubChem CID 134930939) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6R,7R)-7-[(E)-2-(phenylmethoxymethoxy)ethenyl]undec-4-yn-6-ol.
| Compound Name | (6R,7R)-7-[(E)-2-(phenylmethoxymethoxy)ethenyl]undec-4-yn-6-ol |
|---|---|
| PubChem CID | 134930939 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (6R,7R)-7-[(E)-2-(phenylmethoxymethoxy)ethenyl]undec-4-yn-6-ol |
| SMILES | CCCC#C[C@H](O)[C@@H](/C=C/OCOCc1ccccc1)CCCC |
| InChI | InChI=1S/C21H30O3/c1-3-5-8-14-21(22)20(13-6-4-2)15-16-23-18-24-17-19-11-9-7-10-12-19/h7,9-12,15-16,20-22H,3-6,13,17-18H2,1-2H3/b16-15+/t20-,21+/m1/s1 |
| InChIKey | UIWRRELSIVFBNN-NHQVPKDKSA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|