C9H18O3 — CID 10866828
(3R,4R)-non-8-ene-1,3,4-triol (PubChem CID 10866828) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3R,4R)-non-8-ene-1,3,4-triol.
| Compound Name | (3R,4R)-non-8-ene-1,3,4-triol |
|---|---|
| PubChem CID | 10866828 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3R,4R)-non-8-ene-1,3,4-triol |
| SMILES | C=CCCC[C@@H](O)[C@H](O)CCO |
| InChI | InChI=1S/C9H18O3/c1-2-3-4-5-8(11)9(12)6-7-10/h2,8-12H,1,3-7H2/t8-,9-/m1/s1 |
| InChIKey | GMAASTMKPVZLKE-RKDXNWHRSA-N |
| XLogP | 0.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|