C17H32O3Si — CID 166448938
(E,2S,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-5-methyldec-5-en-3-yne-2,8-diol (PubChem CID 166448938) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (E,2S,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-5-methyldec-5-en-3-yne-2,8-diol.
| Compound Name | (E,2S,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-5-methyldec-5-en-3-yne-2,8-diol |
|---|---|
| PubChem CID | 166448938 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (E,2S,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-5-methyldec-5-en-3-yne-2,8-diol |
| SMILES | C/C(C#C[C@H](C)O)=C\C[C@@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-13(9-11-14(2)18)10-12-16(19)15(3)20-21(7,8)17(4,5)6/h10,14-16,18-19H,12H2,1-8H3/b13-10+/t14-,15-,16+/m0/s1 |
| InChIKey | OURLLIPHPVQYNM-FQKMVKHXSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|