C17H34O3Si — CID 123540959
(2S,7R)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-4,8-diene-2,7-diol (PubChem CID 123540959) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (2S,7R)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-4,8-diene-2,7-diol.
| Compound Name | (2S,7R)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-4,8-diene-2,7-diol |
|---|---|
| PubChem CID | 123540959 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2S,7R)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyldeca-4,8-diene-2,7-diol |
| SMILES | CC=C[C@H](O)CC(C)=CC[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O3Si/c1-8-9-15(18)12-14(2)10-11-16(19)13-20-21(6,7)17(3,4)5/h8-10,15-16,18-19H,11-13H2,1-7H3/t15-,16-/m0/s1 |
| InChIKey | SPTMSYNYWUWYRQ-HOTGVXAUSA-N |
| XLogP | 4.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|