C16H32O2Si — CID 134857299
(3R,4E)-2,5-dimethyl-8-triethylsilyloxyocta-1,4-dien-3-ol (PubChem CID 134857299) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (3R,4E)-2,5-dimethyl-8-triethylsilyloxyocta-1,4-dien-3-ol.
| Compound Name | (3R,4E)-2,5-dimethyl-8-triethylsilyloxyocta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 134857299 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (3R,4E)-2,5-dimethyl-8-triethylsilyloxyocta-1,4-dien-3-ol |
| SMILES | C=C(C)[C@H](O)/C=C(\C)CCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H32O2Si/c1-7-19(8-2,9-3)18-12-10-11-15(6)13-16(17)14(4)5/h13,16-17H,4,7-12H2,1-3,5-6H3/b15-13+/t16-/m1/s1 |
| InChIKey | WGKHOJMDXXQTTC-QJPKHSJYSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|