C18H34OSi2 — CID 10639611
(3S,4R)-3-[tert-butyl(dimethyl)silyl]-7-methyl-1-trimethylsilylocta-5,6-dien-1-yn-4-ol (PubChem CID 10639611) has the molecular formula C18H34OSi2 and a molecular weight of 322.64 g/mol. Its IUPAC name is (3S,4R)-3-[tert-butyl(dimethyl)silyl]-7-methyl-1-trimethylsilylocta-5,6-dien-1-yn-4-ol.
| Compound Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]-7-methyl-1-trimethylsilylocta-5,6-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 10639611 |
| Molecular Formula | C18H34OSi2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]-7-methyl-1-trimethylsilylocta-5,6-dien-1-yn-4-ol |
| SMILES | CC(C)=C=C[C@@H](O)[C@H](C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34OSi2/c1-15(2)11-12-16(19)17(13-14-20(6,7)8)21(9,10)18(3,4)5/h12,16-17,19H,1-10H3/t16-,17+/m1/s1 |
| InChIKey | HOKXBTGBLUFXFH-SJORKVTESA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|