C24H46OSi2 — CID 10573421
(3S,4R)-7-tert-butyl-3-[tert-butyl(dimethyl)silyl]-8,8-dimethyl-1-trimethylsilylnona-5,6-dien-1-yn-4-ol (PubChem CID 10573421) has the molecular formula C24H46OSi2 and a molecular weight of 406.80 g/mol. Its IUPAC name is (3S,4R)-7-tert-butyl-3-[tert-butyl(dimethyl)silyl]-8,8-dimethyl-1-trimethylsilylnona-5,6-dien-1-yn-4-ol.
| Compound Name | (3S,4R)-7-tert-butyl-3-[tert-butyl(dimethyl)silyl]-8,8-dimethyl-1-trimethylsilylnona-5,6-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 10573421 |
| Molecular Formula | C24H46OSi2 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (3S,4R)-7-tert-butyl-3-[tert-butyl(dimethyl)silyl]-8,8-dimethyl-1-trimethylsilylnona-5,6-dien-1-yn-4-ol |
| SMILES | CC(C)(C)C(=C=C[C@@H](O)[C@H](C#C[Si](C)(C)C)[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H46OSi2/c1-22(2,3)21(23(4,5)6)16-15-19(25)20(17-18-26(10,11)12)27(13,14)24(7,8)9/h15,19-20,25H,1-14H3/t19-,20+/m1/s1 |
| InChIKey | GQZYMHJCVHLIMJ-UXHICEINSA-N |
| XLogP | 7.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|