C22H36OSi — CID 10427633
(5R,6R)-2-methyl-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol (PubChem CID 10427633) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is (5R,6R)-2-methyl-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol.
| Compound Name | (5R,6R)-2-methyl-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol |
|---|---|
| PubChem CID | 10427633 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (5R,6R)-2-methyl-5-prop-1-ynyl-5-trimethylsilylpentadeca-1,7,8,14-tetraen-6-ol |
| SMILES | C=CCCCCC=C=C[C@@H](O)[C@](C#CC)(CCC(=C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H36OSi/c1-8-10-11-12-13-14-15-16-21(23)22(18-9-2,24(5,6)7)19-17-20(3)4/h8,14,16,21,23H,1,3,10-13,17,19H2,2,4-7H3/t15?,21-,22+/m1/s1 |
| InChIKey | KJIFSTZZNIIUGG-LQJNRQTASA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|