C20H34OSi — CID 134978482
(5R,6R)-2,9,9-trimethyl-6-prop-1-ynyl-6-trimethylsilylundeca-2,3,10-trien-5-ol (PubChem CID 134978482) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is (5R,6R)-2,9,9-trimethyl-6-prop-1-ynyl-6-trimethylsilylundeca-2,3,10-trien-5-ol.
| Compound Name | (5R,6R)-2,9,9-trimethyl-6-prop-1-ynyl-6-trimethylsilylundeca-2,3,10-trien-5-ol |
|---|---|
| PubChem CID | 134978482 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (5R,6R)-2,9,9-trimethyl-6-prop-1-ynyl-6-trimethylsilylundeca-2,3,10-trien-5-ol |
| SMILES | C=CC(C)(C)CC[C@@](C#CC)([C@H](O)C=C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H34OSi/c1-10-14-20(22(7,8)9,16-15-19(5,6)11-2)18(21)13-12-17(3)4/h11,13,18,21H,2,15-16H2,1,3-9H3/t18-,20+/m1/s1 |
| InChIKey | PZPGNTUBCYYQKB-QUCCMNQESA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|