C17H28OSi — CID 15721123
(5R,6R)-2-methyl-6-prop-1-ynyl-6-trimethylsilyldeca-2,3,9-trien-5-ol (PubChem CID 15721123) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (5R,6R)-2-methyl-6-prop-1-ynyl-6-trimethylsilyldeca-2,3,9-trien-5-ol.
| Compound Name | (5R,6R)-2-methyl-6-prop-1-ynyl-6-trimethylsilyldeca-2,3,9-trien-5-ol |
|---|---|
| PubChem CID | 15721123 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (5R,6R)-2-methyl-6-prop-1-ynyl-6-trimethylsilyldeca-2,3,9-trien-5-ol |
| SMILES | C=CCC[C@@](C#CC)([C@H](O)C=C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H28OSi/c1-8-10-14-17(13-9-2,19(5,6)7)16(18)12-11-15(3)4/h8,12,16,18H,1,10,14H2,2-7H3/t16-,17+/m1/s1 |
| InChIKey | FHLPSIRNCYTYAD-SJORKVTESA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|