C13H24OSi — CID 134955513
(4R)-3,3,6-trimethyl-1-trimethylsilylhept-5-en-1-yn-4-ol (PubChem CID 134955513) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (4R)-3,3,6-trimethyl-1-trimethylsilylhept-5-en-1-yn-4-ol.
| Compound Name | (4R)-3,3,6-trimethyl-1-trimethylsilylhept-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 134955513 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (4R)-3,3,6-trimethyl-1-trimethylsilylhept-5-en-1-yn-4-ol |
| SMILES | CC(C)=C[C@@H](O)C(C)(C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-11(2)10-12(14)13(3,4)8-9-15(5,6)7/h10,12,14H,1-7H3/t12-/m1/s1 |
| InChIKey | XLEMBWKIZVIHPB-GFCCVEGCSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|