C11H22OSi — CID 12026104
2-methyl-4-trimethylsilylhepta-4,5-dien-3-ol (PubChem CID 12026104) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is 2-methyl-4-trimethylsilylhepta-4,5-dien-3-ol.
| Compound Name | 2-methyl-4-trimethylsilylhepta-4,5-dien-3-ol |
|---|---|
| PubChem CID | 12026104 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-methyl-4-trimethylsilylhepta-4,5-dien-3-ol |
| SMILES | CC=C=C(C(O)C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-7-8-10(13(4,5)6)11(12)9(2)3/h7,9,11-12H,1-6H3 |
| InChIKey | CIGKGZWKUNVOJH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|