C10H18O — CID 12555439
2,6-dimethylocta-4,5-dien-3-ol (PubChem CID 12555439) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,6-dimethylocta-4,5-dien-3-ol.
| Compound Name | 2,6-dimethylocta-4,5-dien-3-ol |
|---|---|
| PubChem CID | 12555439 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,6-dimethylocta-4,5-dien-3-ol |
| SMILES | CCC(C)=C=CC(O)C(C)C |
| InChI | InChI=1S/C10H18O/c1-5-9(4)6-7-10(11)8(2)3/h7-8,10-11H,5H2,1-4H3 |
| InChIKey | UPVAQNRVYVEIIT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |