C8H14O — CID 11615166
6-methylhepta-1,2-dien-4-ol (PubChem CID 11615166) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is 6-methylhepta-1,2-dien-4-ol.
| Compound Name | 6-methylhepta-1,2-dien-4-ol |
|---|---|
| PubChem CID | 11615166 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 6-methylhepta-1,2-dien-4-ol |
| SMILES | C=C=CC(O)CC(C)C |
| InChI | InChI=1S/C8H14O/c1-4-5-8(9)6-7(2)3/h5,7-9H,1,6H2,2-3H3 |
| InChIKey | SVHSCTCTNYDDRA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |