C7H12O — CID 10986182
2-methylhexa-4,5-dien-3-ol (PubChem CID 10986182) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is 2-methylhexa-4,5-dien-3-ol.
| Compound Name | 2-methylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 10986182 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 2-methylhexa-4,5-dien-3-ol |
| SMILES | C=C=CC(O)C(C)C |
| InChI | InChI=1S/C7H12O/c1-4-5-7(8)6(2)3/h5-8H,1H2,2-3H3 |
| InChIKey | UPSSKUPOXPIJLM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |