About 2-methylhexa-4,5-dien-3-ol
2-methylhexa-4,5-dien-3-ol (PubChem CID 10986182) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is 2-methylhexa-4,5-dien-3-ol.
Molecular Properties
| Compound Name | 2-methylhexa-4,5-dien-3-ol |
| PubChem CID | 10986182 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 2-methylhexa-4,5-dien-3-ol |
| SMILES | C=C=CC(O)C(C)C |
| InChI | InChI=1S/C7H12O/c1-4-5-7(8)6(2)3/h5-8H,1H2,2-3H3 |
| InChIKey | UPSSKUPOXPIJLM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylhexa-4,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexa-4,5-dien-3-ol?
The IUPAC name of 2-methylhexa-4,5-dien-3-ol (CID 10986182) is 2-methylhexa-4,5-dien-3-ol.
What is the SMILES notation for 2-methylhexa-4,5-dien-3-ol?
The canonical SMILES for 2-methylhexa-4,5-dien-3-ol is C=C=CC(O)C(C)C.
What is the InChIKey of 2-methylhexa-4,5-dien-3-ol?
The InChIKey is UPSSKUPOXPIJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O/c1-4-5-7(8)6(2)3/h5-8H,1H2,2-3H3.
What are the key properties of 2-methylhexa-4,5-dien-3-ol?
2-methylhexa-4,5-dien-3-ol has a molecular weight of 112.17 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexa-4,5-dien-3-ol is sourced from PubChem (CID 10986182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).