About 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol
7-bromo-2,6-dimethylhepta-4,5-dien-3-ol (PubChem CID 11241439) has the molecular formula C9H15BrO
and a molecular weight of 219.12 g/mol. Its IUPAC name is 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol.
Molecular Properties
| Compound Name | 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol |
| PubChem CID | 11241439 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol |
| SMILES | CC(=C=CC(O)C(C)C)CBr |
| InChI | InChI=1S/C9H15BrO/c1-7(2)9(11)5-4-8(3)6-10/h5,7,9,11H,6H2,1-3H3 |
| InChIKey | UMONIGCZNPTJKL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol?
The IUPAC name of 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol (CID 11241439) is 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol.
What is the SMILES notation for 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol?
The canonical SMILES for 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol is CC(=C=CC(O)C(C)C)CBr.
What is the InChIKey of 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol?
The InChIKey is UMONIGCZNPTJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO/c1-7(2)9(11)5-4-8(3)6-10/h5,7,9,11H,6H2,1-3H3.
What are the key properties of 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol?
7-bromo-2,6-dimethylhepta-4,5-dien-3-ol has a molecular weight of 219.12 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol is sourced from PubChem (CID 11241439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).