C9H15BrO — CID 11241439
7-bromo-2,6-dimethylhepta-4,5-dien-3-ol (PubChem CID 11241439) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol.
| Compound Name | 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol |
|---|---|
| PubChem CID | 11241439 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 7-bromo-2,6-dimethylhepta-4,5-dien-3-ol |
| SMILES | CC(=C=CC(O)C(C)C)CBr |
| InChI | InChI=1S/C9H15BrO/c1-7(2)9(11)5-4-8(3)6-10/h5,7,9,11H,6H2,1-3H3 |
| InChIKey | UMONIGCZNPTJKL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|