C10H22O3 — CID 46849978
(3S,4S,6R)-2,7-dimethyloctane-3,4,6-triol (PubChem CID 46849978) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is (3S,4S,6R)-2,7-dimethyloctane-3,4,6-triol.
| Compound Name | (3S,4S,6R)-2,7-dimethyloctane-3,4,6-triol |
|---|---|
| PubChem CID | 46849978 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (3S,4S,6R)-2,7-dimethyloctane-3,4,6-triol |
| SMILES | CC(C)[C@H](O)C[C@H](O)[C@@H](O)C(C)C |
| InChI | InChI=1S/C10H22O3/c1-6(2)8(11)5-9(12)10(13)7(3)4/h6-13H,5H2,1-4H3/t8-,9+,10+/m1/s1 |
| InChIKey | ZWSLQVYMFUDODX-UTLUCORTSA-N |
| XLogP | 0.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |