C10H23NO — CID 167246678
(3R)-5-amino-2,7-dimethyloctan-3-ol (PubChem CID 167246678) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is (3R)-5-amino-2,7-dimethyloctan-3-ol.
| Compound Name | (3R)-5-amino-2,7-dimethyloctan-3-ol |
|---|---|
| PubChem CID | 167246678 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | (3R)-5-amino-2,7-dimethyloctan-3-ol |
| SMILES | CC(C)CC(N)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C10H23NO/c1-7(2)5-9(11)6-10(12)8(3)4/h7-10,12H,5-6,11H2,1-4H3/t9?,10-/m1/s1 |
| InChIKey | ZHODIBBTEVZYDO-QVDQXJPCSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |