C13H29NO3 — CID 89065903
9-amino-2-methyldodecane-3,5,7-triol (PubChem CID 89065903) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is 9-amino-2-methyldodecane-3,5,7-triol.
| Compound Name | 9-amino-2-methyldodecane-3,5,7-triol |
|---|---|
| PubChem CID | 89065903 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 9-amino-2-methyldodecane-3,5,7-triol |
| SMILES | CCCC(N)CC(O)CC(O)CC(O)C(C)C |
| InChI | InChI=1S/C13H29NO3/c1-4-5-10(14)6-11(15)7-12(16)8-13(17)9(2)3/h9-13,15-17H,4-8,14H2,1-3H3 |
| InChIKey | QGDCIUHJCKLVSK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |