C9H19NO — CID 16744633
(4S,6S)-6-aminonon-1-en-4-ol (PubChem CID 16744633) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (4S,6S)-6-aminonon-1-en-4-ol.
| Compound Name | (4S,6S)-6-aminonon-1-en-4-ol |
|---|---|
| PubChem CID | 16744633 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (4S,6S)-6-aminonon-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](N)CCC |
| InChI | InChI=1S/C9H19NO/c1-3-5-8(10)7-9(11)6-4-2/h4,8-9,11H,2-3,5-7,10H2,1H3/t8-,9-/m0/s1 |
| InChIKey | VKSGZNUSXDSTCX-IUCAKERBSA-N |
| XLogP | 1.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|