C8H19FN2 — CID 176716912
(2S,4R)-2-fluoro-6-methylheptane-1,4-diamine (PubChem CID 176716912) has the molecular formula C8H19FN2 and a molecular weight of 162.25 g/mol. Its IUPAC name is (2S,4R)-2-fluoro-6-methylheptane-1,4-diamine.
| Compound Name | (2S,4R)-2-fluoro-6-methylheptane-1,4-diamine |
|---|---|
| PubChem CID | 176716912 |
| Molecular Formula | C8H19FN2 |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.15 |
| IUPAC Name | (2S,4R)-2-fluoro-6-methylheptane-1,4-diamine |
| SMILES | CC(C)C[C@@H](N)C[C@H](F)CN |
| InChI | InChI=1S/C8H19FN2/c1-6(2)3-8(11)4-7(9)5-10/h6-8H,3-5,10-11H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | LORQRRHUILTWTH-JGVFFNPUSA-N |
| XLogP | 1.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |