C8H18F2N2 — CID 115407411
1-N-(2,2-difluoroethyl)-4-methylpentane-1,2-diamine (PubChem CID 115407411) has the molecular formula C8H18F2N2 and a molecular weight of 180.24 g/mol. Its IUPAC name is 1-N-(2,2-difluoroethyl)-4-methylpentane-1,2-diamine.
| Compound Name | 1-N-(2,2-difluoroethyl)-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 115407411 |
| Molecular Formula | C8H18F2N2 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-N-(2,2-difluoroethyl)-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(N)CNCC(F)F |
| InChI | InChI=1S/C8H18F2N2/c1-6(2)3-7(11)4-12-5-8(9)10/h6-8,12H,3-5,11H2,1-2H3 |
| InChIKey | NPMUZYAEKORBHD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |