C7H16N2O2 — CID 155804554
[(2S)-2-amino-4-methylpentyl]carbamic acid (PubChem CID 155804554) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is [(2S)-2-amino-4-methylpentyl]carbamic acid.
| Compound Name | [(2S)-2-amino-4-methylpentyl]carbamic acid |
|---|---|
| PubChem CID | 155804554 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | [(2S)-2-amino-4-methylpentyl]carbamic acid |
| SMILES | CC(C)C[C@H](N)CNC(=O)O |
| InChI | InChI=1S/C7H16N2O2/c1-5(2)3-6(8)4-9-7(10)11/h5-6,9H,3-4,8H2,1-2H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | MUXHOSWJKVCQIF-LURJTMIESA-N |
| XLogP | 0.63 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |