C8H18N2O2 — CID 87077916
[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid (PubChem CID 87077916) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid.
| Compound Name | [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid |
|---|---|
| PubChem CID | 87077916 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid |
| SMILES | CC(C)(C)C[C@@H](N)CNC(=O)O |
| InChI | InChI=1S/C8H18N2O2/c1-8(2,3)4-6(9)5-10-7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | RASDEZDPSYGTNU-ZCFIWIBFSA-N |
| XLogP | 1.02 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |