[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid

C8H18N2O2 — CID 87077916

IUPAC[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid
SMILESCC(C)(C)C[C@@H](N)CNC(=O)O
InChIInChI=1S/C8H18N2O2/c1-8(2,3)4-6(9)5-10-7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1
InChIKeyRASDEZDPSYGTNU-ZCFIWIBFSA-N
MW174.24 g/mol
LogP1.02
Rot. Bonds3

About [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid

[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid (PubChem CID 87077916) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid.

Molecular Properties

Compound Name[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid
PubChem CID87077916
Molecular FormulaC8H18N2O2
Molecular Weight174.24 g/mol
Exact Mass174.14
IUPAC Name[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid
SMILESCC(C)(C)C[C@@H](N)CNC(=O)O
InChIInChI=1S/C8H18N2O2/c1-8(2,3)4-6(9)5-10-7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1
InChIKeyRASDEZDPSYGTNU-ZCFIWIBFSA-N
XLogP1.02
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 51.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid?
The IUPAC name of [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid (CID 87077916) is [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid.
What is the SMILES notation for [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid?
The canonical SMILES for [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid is CC(C)(C)C[C@@H](N)CNC(=O)O.
What is the InChIKey of [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid?
The InChIKey is RASDEZDPSYGTNU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-8(2,3)4-6(9)5-10-7(11)12/h6,10H,4-5,9H2,1-3H3,(H,11,12)/t6-/m1/s1.
What are the key properties of [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid?
[(2R)-2-amino-4,4-dimethylpentyl]carbamic acid has a molecular weight of 174.24 g/mol, XLogP of 1.02, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-amino-4,4-dimethylpentyl]carbamic acid is sourced from PubChem (CID 87077916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).