C15H23FN2O — CID 107158406
N-(2-amino-4,4-dimethylpentyl)-2-fluoro-3-methylbenzamide (PubChem CID 107158406) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is N-(2-amino-4,4-dimethylpentyl)-2-fluoro-3-methylbenzamide.
| Compound Name | N-(2-amino-4,4-dimethylpentyl)-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 107158406 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-(2-amino-4,4-dimethylpentyl)-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC(N)CC(C)(C)C)c1F |
| InChI | InChI=1S/C15H23FN2O/c1-10-6-5-7-12(13(10)16)14(19)18-9-11(17)8-15(2,3)4/h5-7,11H,8-9,17H2,1-4H3,(H,18,19) |
| InChIKey | OELIFNNRYGCXFF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |