C14H30O3 — CID 58455255
2,8-dimethyl-4-propan-2-ylnonane-3,5,6-triol (PubChem CID 58455255) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 2,8-dimethyl-4-propan-2-ylnonane-3,5,6-triol.
| Compound Name | 2,8-dimethyl-4-propan-2-ylnonane-3,5,6-triol |
|---|---|
| PubChem CID | 58455255 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 2,8-dimethyl-4-propan-2-ylnonane-3,5,6-triol |
| SMILES | CC(C)CC(O)C(O)C(C(C)C)C(O)C(C)C |
| InChI | InChI=1S/C14H30O3/c1-8(2)7-11(15)14(17)12(9(3)4)13(16)10(5)6/h8-17H,7H2,1-6H3 |
| InChIKey | RSLUYPPOEFYLFA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |