C10H20O5 — CID 159890436
(3R,4S,5R,6R)-3,4,5,6-tetrahydroxy-8-methylnonan-2-one (PubChem CID 159890436) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5,6-tetrahydroxy-8-methylnonan-2-one.
| Compound Name | (3R,4S,5R,6R)-3,4,5,6-tetrahydroxy-8-methylnonan-2-one |
|---|---|
| PubChem CID | 159890436 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5,6-tetrahydroxy-8-methylnonan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CC(C)C |
| InChI | InChI=1S/C10H20O5/c1-5(2)4-7(12)9(14)10(15)8(13)6(3)11/h5,7-10,12-15H,4H2,1-3H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | WIXIQDHJHMYSCR-UTINFBMNSA-N |
| XLogP | -0.93 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |