C10H23NO — CID 118053388
(4S)-2,6-dimethyl-4-(methylamino)heptan-3-ol (PubChem CID 118053388) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is (4S)-2,6-dimethyl-4-(methylamino)heptan-3-ol.
| Compound Name | (4S)-2,6-dimethyl-4-(methylamino)heptan-3-ol |
|---|---|
| PubChem CID | 118053388 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | (4S)-2,6-dimethyl-4-(methylamino)heptan-3-ol |
| SMILES | CN[C@@H](CC(C)C)C(O)C(C)C |
| InChI | InChI=1S/C10H23NO/c1-7(2)6-9(11-5)10(12)8(3)4/h7-12H,6H2,1-5H3/t9-,10?/m0/s1 |
| InChIKey | LBAKLRRHPOZPIR-RGURZIINSA-N |
| XLogP | 1.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |