C5H13NO2 — CID 59886106
(2S,3R)-2-(methylamino)butane-1,3-diol (PubChem CID 59886106) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is (2S,3R)-2-(methylamino)butane-1,3-diol.
| Compound Name | (2S,3R)-2-(methylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 59886106 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | (2S,3R)-2-(methylamino)butane-1,3-diol |
| SMILES | CN[C@@H](CO)[C@@H](C)O |
| InChI | InChI=1S/C5H13NO2/c1-4(8)5(3-7)6-2/h4-8H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | WVHGVRHEBRYJRN-UHNVWZDZSA-N |
| XLogP | -1.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |