C4H11NO3 — CID 54575342
2-(hydroxyamino)butane-1,3-diol (PubChem CID 54575342) has the molecular formula C4H11NO3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 2-(hydroxyamino)butane-1,3-diol.
| Compound Name | 2-(hydroxyamino)butane-1,3-diol |
|---|---|
| PubChem CID | 54575342 |
| Molecular Formula | C4H11NO3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | 2-(hydroxyamino)butane-1,3-diol |
| SMILES | CC(O)C(CO)NO |
| InChI | InChI=1S/C4H11NO3/c1-3(7)4(2-6)5-8/h3-8H,2H2,1H3 |
| InChIKey | QGXDFIWMMXYDLB-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|