methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate

C8H17NO4 — CID 90207580

IUPACmethyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate
SMILESCOC(=O)CCN[C@H](CO)[C@@H](C)O
InChIInChI=1S/C8H17NO4/c1-6(11)7(5-10)9-4-3-8(12)13-2/h6-7,9-11H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyBMDANVWXSJUGAA-RNFRBKRXSA-N
MW191.23 g/mol
LogP-1.12
Rot. Bonds6

About methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate

methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate (PubChem CID 90207580) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate
PubChem CID90207580
Molecular FormulaC8H17NO4
Molecular Weight191.23 g/mol
Exact Mass191.12
IUPAC Namemethyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate
SMILESCOC(=O)CCN[C@H](CO)[C@@H](C)O
InChIInChI=1S/C8H17NO4/c1-6(11)7(5-10)9-4-3-8(12)13-2/h6-7,9-11H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyBMDANVWXSJUGAA-RNFRBKRXSA-N
XLogP-1.12
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 5-1.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate?
The IUPAC name of methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate (CID 90207580) is methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate.
What is the SMILES notation for methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate?
The canonical SMILES for methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate is COC(=O)CCN[C@H](CO)[C@@H](C)O.
What is the InChIKey of methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate?
The InChIKey is BMDANVWXSJUGAA-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H17NO4/c1-6(11)7(5-10)9-4-3-8(12)13-2/h6-7,9-11H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate?
methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate has a molecular weight of 191.23 g/mol, XLogP of -1.12, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(2R,3R)-1,3-dihydroxybutan-2-yl]amino]propanoate is sourced from PubChem (CID 90207580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).