3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid

C7H17NO5S — CID 54026549

IUPAC3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid
SMILESCC(O)C(CO)NCCCS(=O)(=O)O
InChIInChI=1S/C7H17NO5S/c1-6(10)7(5-9)8-3-2-4-14(11,12)13/h6-10H,2-5H2,1H3,(H,11,12,13)
InChIKeyLCOVEGBBEDFQDQ-UHFFFAOYSA-N
MW227.28 g/mol
LogP-1.40
Rot. Bonds7

About 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid

3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid (PubChem CID 54026549) has the molecular formula C7H17NO5S and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid.

Molecular Properties

Compound Name3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid
PubChem CID54026549
Molecular FormulaC7H17NO5S
Molecular Weight227.28 g/mol
Exact Mass227.08
IUPAC Name3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid
SMILESCC(O)C(CO)NCCCS(=O)(=O)O
InChIInChI=1S/C7H17NO5S/c1-6(10)7(5-9)8-3-2-4-14(11,12)13/h6-10H,2-5H2,1H3,(H,11,12,13)
InChIKeyLCOVEGBBEDFQDQ-UHFFFAOYSA-N
XLogP-1.40
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.28
LogP ≤ 5-1.40
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid?
The IUPAC name of 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid (CID 54026549) is 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid.
What is the SMILES notation for 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid?
The canonical SMILES for 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid is CC(O)C(CO)NCCCS(=O)(=O)O.
What is the InChIKey of 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid?
The InChIKey is LCOVEGBBEDFQDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO5S/c1-6(10)7(5-9)8-3-2-4-14(11,12)13/h6-10H,2-5H2,1H3,(H,11,12,13).
What are the key properties of 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid?
3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid has a molecular weight of 227.28 g/mol, XLogP of -1.40, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydroxybutan-2-ylamino)propane-1-sulfonic acid is sourced from PubChem (CID 54026549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).