C12H28N2O3S — CID 142978487
3-[[(2S)-1-(tert-butylamino)-3-methylbutan-2-yl]amino]propane-1-sulfonic acid (PubChem CID 142978487) has the molecular formula C12H28N2O3S and a molecular weight of 280.43 g/mol. Its IUPAC name is 3-[[(2S)-1-(tert-butylamino)-3-methylbutan-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(2S)-1-(tert-butylamino)-3-methylbutan-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 142978487 |
| Molecular Formula | C12H28N2O3S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-[[(2S)-1-(tert-butylamino)-3-methylbutan-2-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)[C@@H](CNC(C)(C)C)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C12H28N2O3S/c1-10(2)11(9-14-12(3,4)5)13-7-6-8-18(15,16)17/h10-11,13-14H,6-9H2,1-5H3,(H,15,16,17)/t11-/m1/s1 |
| InChIKey | BIKKGOGSWLDJHE-LLVKDONJSA-N |
| XLogP | 1.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|