C6H15NNaO3S — CID 87664678
CID 87664678 (PubChem CID 87664678) has the molecular formula C6H15NNaO3S and a molecular weight of 204.25 g/mol.
| Compound Name | CID 87664678 |
|---|---|
| PubChem CID | 87664678 |
| Molecular Formula | C6H15NNaO3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | — |
| SMILES | CC(C)(C)NCCS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C6H15NO3S.Na/c1-6(2,3)7-4-5-11(8,9)10;/h7H,4-5H2,1-3H3,(H,8,9,10); |
| InChIKey | UPGTUVUBPLKKRS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|