C16H27NO2S — CID 64644839
N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpropan-2-amine (PubChem CID 64644839) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 64644839 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27NO2S/c1-15(2,3)13-7-9-14(10-8-13)20(18,19)12-11-17-16(4,5)6/h7-10,17H,11-12H2,1-6H3 |
| InChIKey | IXKRSKLFTPCVCN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |