C16H25NO3S2 — CID 95305165
(2S)-N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylsulfanylpropanamide (PubChem CID 95305165) has the molecular formula C16H25NO3S2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (2S)-N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylsulfanylpropanamide.
| Compound Name | (2S)-N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 95305165 |
| Molecular Formula | C16H25NO3S2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2S)-N-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylsulfanylpropanamide |
| SMILES | CS[C@@H](C)C(=O)NCCS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO3S2/c1-12(21-5)15(18)17-10-11-22(19,20)14-8-6-13(7-9-14)16(2,3)4/h6-9,12H,10-11H2,1-5H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | LMGZPPGNWWZAJO-LBPRGKRZSA-N |
| XLogP | 2.63 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |