C16H27NO2S — CID 64646630
5-(4-tert-butylphenyl)sulfonyl-N-methylpentan-2-amine (PubChem CID 64646630) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)sulfonyl-N-methylpentan-2-amine.
| Compound Name | 5-(4-tert-butylphenyl)sulfonyl-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 64646630 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5-(4-tert-butylphenyl)sulfonyl-N-methylpentan-2-amine |
| SMILES | CNC(C)CCCS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27NO2S/c1-13(17-5)7-6-12-20(18,19)15-10-8-14(9-11-15)16(2,3)4/h8-11,13,17H,6-7,12H2,1-5H3 |
| InChIKey | APHSDLLEVYHTKO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |