C18H29NO3S — CID 110415591
3-(4-tert-butylphenyl)sulfonyl-N-(3-methylbutyl)propanamide (PubChem CID 110415591) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-N-(3-methylbutyl)propanamide.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 110415591 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)CCS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO3S/c1-14(2)10-12-19-17(20)11-13-23(21,22)16-8-6-15(7-9-16)18(3,4)5/h6-9,14H,10-13H2,1-5H3,(H,19,20) |
| InChIKey | OTPZSENTCCQLAD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |