C14H21NO4S — CID 115703740
3-(benzenesulfonyl)-N-(3-hydroxypentyl)propanamide (PubChem CID 115703740) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3-hydroxypentyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3-hydroxypentyl)propanamide |
|---|---|
| PubChem CID | 115703740 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3-hydroxypentyl)propanamide |
| SMILES | CCC(O)CCNC(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S/c1-2-12(16)8-10-15-14(17)9-11-20(18,19)13-6-4-3-5-7-13/h3-7,12,16H,2,8-11H2,1H3,(H,15,17) |
| InChIKey | IPGVXCZPGJRNIT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |