C15H17NO4S2 — CID 90500079
3-(benzenesulfonyl)-N-(2-hydroxy-2-thiophen-2-ylethyl)propanamide (PubChem CID 90500079) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(2-hydroxy-2-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(2-hydroxy-2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 90500079 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(2-hydroxy-2-thiophen-2-ylethyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)NCC(O)c1cccs1 |
| InChI | InChI=1S/C15H17NO4S2/c17-13(14-7-4-9-21-14)11-16-15(18)8-10-22(19,20)12-5-2-1-3-6-12/h1-7,9,13,17H,8,10-11H2,(H,16,18) |
| InChIKey | LJWNMZVQAMWFNB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |