C13H15NO3S2 — CID 60898378
2-(4-methylsulfonylanilino)-1-thiophen-2-ylethanol (PubChem CID 60898378) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(4-methylsulfonylanilino)-1-thiophen-2-ylethanol.
| Compound Name | 2-(4-methylsulfonylanilino)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 60898378 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(4-methylsulfonylanilino)-1-thiophen-2-ylethanol |
| SMILES | CS(=O)(=O)c1ccc(NCC(O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H15NO3S2/c1-19(16,17)11-6-4-10(5-7-11)14-9-12(15)13-3-2-8-18-13/h2-8,12,14-15H,9H2,1H3 |
| InChIKey | HNNBQBVUTSLBOM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |