C10H18N2O3S2 — CID 113221919
N-[3-[(2-hydroxy-2-thiophen-2-ylethyl)amino]propyl]methanesulfonamide (PubChem CID 113221919) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[3-[(2-hydroxy-2-thiophen-2-ylethyl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(2-hydroxy-2-thiophen-2-ylethyl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 113221919 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-[3-[(2-hydroxy-2-thiophen-2-ylethyl)amino]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNCC(O)c1cccs1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-17(14,15)12-6-3-5-11-8-9(13)10-4-2-7-16-10/h2,4,7,9,11-13H,3,5-6,8H2,1H3 |
| InChIKey | VPNMFLSPNAUVKQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|