C10H17NO3S2 — CID 87816922
3-(2-thiophen-2-ylpropylamino)propane-1-sulfonic acid (PubChem CID 87816922) has the molecular formula C10H17NO3S2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-(2-thiophen-2-ylpropylamino)propane-1-sulfonic acid.
| Compound Name | 3-(2-thiophen-2-ylpropylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87816922 |
| Molecular Formula | C10H17NO3S2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(2-thiophen-2-ylpropylamino)propane-1-sulfonic acid |
| SMILES | CC(CNCCCS(=O)(=O)O)c1cccs1 |
| InChI | InChI=1S/C10H17NO3S2/c1-9(10-4-2-6-15-10)8-11-5-3-7-16(12,13)14/h2,4,6,9,11H,3,5,7-8H2,1H3,(H,12,13,14) |
| InChIKey | PBUYWPXUOAIVHF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|