C13H17NO2S3 — CID 54905323
N-(dithiophen-2-ylmethyl)-3-methylsulfonylpropan-1-amine (PubChem CID 54905323) has the molecular formula C13H17NO2S3 and a molecular weight of 315.48 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-3-methylsulfonylpropan-1-amine.
| Compound Name | N-(dithiophen-2-ylmethyl)-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 54905323 |
| Molecular Formula | C13H17NO2S3 |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCCNC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C13H17NO2S3/c1-19(15,16)10-4-7-14-13(11-5-2-8-17-11)12-6-3-9-18-12/h2-3,5-6,8-9,13-14H,4,7,10H2,1H3 |
| InChIKey | QPLLRDOYEDBRGM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|