C13H19N3O3S — CID 61020764
N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-methylsulfonylpropan-1-amine (PubChem CID 61020764) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 61020764 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-methylsulfonylpropan-1-amine |
| SMILES | Cn1ccnc1C(NCCCS(C)(=O)=O)c1ccco1 |
| InChI | InChI=1S/C13H19N3O3S/c1-16-8-7-15-13(16)12(11-5-3-9-19-11)14-6-4-10-20(2,17)18/h3,5,7-9,12,14H,4,6,10H2,1-2H3 |
| InChIKey | OCDHNUVWRIANAO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|