C15H23N3O3 — CID 43770887
N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 43770887) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 43770887 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCCNC(c1ccco1)c1nccn1C |
| InChI | InChI=1S/C15H23N3O3/c1-18-8-7-17-15(18)14(13-5-3-10-21-13)16-6-4-9-20-12-11-19-2/h3,5,7-8,10,14,16H,4,6,9,11-12H2,1-2H3 |
| InChIKey | HJDNEPBKOMNVLV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|