C12H14F3N3OS — CID 106427266
N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 106427266) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106427266 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | Cn1ccnc1C(NCCSC(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C12H14F3N3OS/c1-18-6-4-17-11(18)10(9-3-2-7-19-9)16-5-8-20-12(13,14)15/h2-4,6-7,10,16H,5,8H2,1H3 |
| InChIKey | URQRGMDJIBXIBX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|