C12H17N3O3S — CID 54931888
N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-methylsulfonylethanamine (PubChem CID 54931888) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-methylsulfonylethanamine.
| Compound Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 54931888 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-[furan-2-yl-(1-methylimidazol-2-yl)methyl]-2-methylsulfonylethanamine |
| SMILES | Cn1ccnc1C(NCCS(C)(=O)=O)c1ccco1 |
| InChI | InChI=1S/C12H17N3O3S/c1-15-7-5-14-12(15)11(10-4-3-8-18-10)13-6-9-19(2,16)17/h3-5,7-8,11,13H,6,9H2,1-2H3 |
| InChIKey | OGPBYIRIRNKSDX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |