C16H19N3S2 — CID 62040679
N-(dithiophen-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine (PubChem CID 62040679) has the molecular formula C16H19N3S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine.
| Compound Name | N-(dithiophen-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 62040679 |
| Molecular Formula | C16H19N3S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
| SMILES | Cc1[nH]ncc1CCCNC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H19N3S2/c1-12-13(11-18-19-12)5-2-8-17-16(14-6-3-9-20-14)15-7-4-10-21-15/h3-4,6-7,9-11,16-17H,2,5,8H2,1H3,(H,18,19) |
| InChIKey | LDWHVVVBQBYBRP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|