C15H23N3S — CID 62038123
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine (PubChem CID 62038123) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 62038123 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
| SMILES | Cc1cc(C(C)NCCCc2cn[nH]c2C)c(C)s1 |
| InChI | InChI=1S/C15H23N3S/c1-10-8-15(13(4)19-10)12(3)16-7-5-6-14-9-17-18-11(14)2/h8-9,12,16H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | YUKQHRFALIODDG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|